C21H35BO5 — CID 142390817
2-(4-butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;tert-butyl formate (PubChem CID 142390817) has the molecular formula C21H35BO5 and a molecular weight of 378.32 g/mol. Its IUPAC name is 2-(4-butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;tert-butyl formate.
| Compound Name | 2-(4-butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;tert-butyl formate |
|---|---|
| PubChem CID | 142390817 |
| Molecular Formula | C21H35BO5 |
| Molecular Weight | 378.32 g/mol |
| Exact Mass | 378.26 |
| IUPAC Name | 2-(4-butoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.CCCCOc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C16H25BO3.C5H10O2/c1-6-7-12-18-14-10-8-13(9-11-14)17-19-15(2,3)16(4,5)20-17;1-5(2,3)7-4-6/h8-11H,6-7,12H2,1-5H3;4H,1-3H3 |
| InChIKey | WAKOLAHFMQFFQG-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.32 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|