C31H53BO9 — CID 58473716
1-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]-8-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]octan-3-one (PubChem CID 58473716) has the molecular formula C31H53BO9 and a molecular weight of 580.57 g/mol. Its IUPAC name is 1-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]-8-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]octan-3-one.
| Compound Name | 1-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]-8-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]octan-3-one |
|---|---|
| PubChem CID | 58473716 |
| Molecular Formula | C31H53BO9 |
| Molecular Weight | 580.57 g/mol |
| Exact Mass | 580.38 |
| IUPAC Name | 1-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]-8-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]octan-3-one |
| SMILES | CCCOCCOCCOCCOCCOCCC(=O)CCCCCOc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C31H53BO9/c1-6-16-34-19-21-36-23-25-38-26-24-37-22-20-35-18-15-28(33)10-8-7-9-17-39-29-13-11-27(12-14-29)32-40-30(2,3)31(4,5)41-32/h11-14H,6-10,15-26H2,1-5H3 |
| InChIKey | LKVZZIRRLHSDRG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|