C15H22BNaO6S — CID 175190620
sodium 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propane-1-sulfonate (PubChem CID 175190620) has the molecular formula C15H22BNaO6S and a molecular weight of 364.20 g/mol. Its IUPAC name is sodium 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propane-1-sulfonate.
| Compound Name | sodium 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propane-1-sulfonate |
|---|---|
| PubChem CID | 175190620 |
| Molecular Formula | C15H22BNaO6S |
| Molecular Weight | 364.20 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | sodium 3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]propane-1-sulfonate |
| SMILES | CC1(C)OB(c2ccc(OCCCS(=O)(=O)[O-])cc2)OC1(C)C.[Na+] |
| InChI | InChI=1S/C15H23BO6S.Na/c1-14(2)15(3,4)22-16(21-14)12-6-8-13(9-7-12)20-10-5-11-23(17,18)19;/h6-9H,5,10-11H2,1-4H3,(H,17,18,19);/q;+1/p-1 |
| InChIKey | KVFRXRMKQCQOKF-UHFFFAOYSA-M |
| XLogP | -1.70 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.20 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|