C20H25BO6S — CID 86661967
2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl benzenesulfonate (PubChem CID 86661967) has the molecular formula C20H25BO6S and a molecular weight of 404.29 g/mol. Its IUPAC name is 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl benzenesulfonate.
| Compound Name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl benzenesulfonate |
|---|---|
| PubChem CID | 86661967 |
| Molecular Formula | C20H25BO6S |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]ethyl benzenesulfonate |
| SMILES | CC1(C)OB(c2ccc(OCCOS(=O)(=O)c3ccccc3)cc2)OC1(C)C |
| InChI | InChI=1S/C20H25BO6S/c1-19(2)20(3,4)27-21(26-19)16-10-12-17(13-11-16)24-14-15-25-28(22,23)18-8-6-5-7-9-18/h5-13H,14-15H2,1-4H3 |
| InChIKey | MBBXSMWZEKLMAO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|