C16H23BO5S — CID 177227874
3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]thietane 1,1-dioxide (PubChem CID 177227874) has the molecular formula C16H23BO5S and a molecular weight of 338.23 g/mol. Its IUPAC name is 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]thietane 1,1-dioxide.
| Compound Name | 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]thietane 1,1-dioxide |
|---|---|
| PubChem CID | 177227874 |
| Molecular Formula | C16H23BO5S |
| Molecular Weight | 338.23 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 3-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]methyl]thietane 1,1-dioxide |
| SMILES | CC1(C)OB(c2ccc(OCC3CS(=O)(=O)C3)cc2)OC1(C)C |
| InChI | InChI=1S/C16H23BO5S/c1-15(2)16(3,4)22-17(21-15)13-5-7-14(8-6-13)20-9-12-10-23(18,19)11-12/h5-8,12H,9-11H2,1-4H3 |
| InChIKey | DWONRBQBKMUIRP-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|