C25H43BO5Si — CID 175753270
methyl 3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-tri(propan-2-yl)silyloxyphenyl]propanoate (PubChem CID 175753270) has the molecular formula C25H43BO5Si and a molecular weight of 462.51 g/mol. Its IUPAC name is methyl 3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-tri(propan-2-yl)silyloxyphenyl]propanoate.
| Compound Name | methyl 3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-tri(propan-2-yl)silyloxyphenyl]propanoate |
|---|---|
| PubChem CID | 175753270 |
| Molecular Formula | C25H43BO5Si |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | methyl 3-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-tri(propan-2-yl)silyloxyphenyl]propanoate |
| SMILES | COC(=O)CCc1cc(O[Si](C(C)C)(C(C)C)C(C)C)cc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C25H43BO5Si/c1-17(2)32(18(3)4,19(5)6)29-22-15-20(12-13-23(27)28-11)14-21(16-22)26-30-24(7,8)25(9,10)31-26/h14-19H,12-13H2,1-11H3 |
| InChIKey | DEEJNLBUBVXKGG-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|