C22H39BO4Si — CID 90116676
[3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-tri(propan-2-yl)silane (PubChem CID 90116676) has the molecular formula C22H39BO4Si and a molecular weight of 406.45 g/mol. Its IUPAC name is [3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-tri(propan-2-yl)silane.
| Compound Name | [3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 90116676 |
| Molecular Formula | C22H39BO4Si |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | [3-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-tri(propan-2-yl)silane |
| SMILES | COc1cc(O[Si](C(C)C)(C(C)C)C(C)C)ccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H39BO4Si/c1-15(2)28(16(3)4,17(5)6)25-18-12-13-19(20(14-18)24-11)23-26-21(7,8)22(9,10)27-23/h12-17H,1-11H3 |
| InChIKey | VBFRIQGINFTQCC-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|