C20H22BNO3 — CID 171586084
2-[4-(4-isocyanophenyl)-2-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171586084) has the molecular formula C20H22BNO3 and a molecular weight of 335.21 g/mol. Its IUPAC name is 2-[4-(4-isocyanophenyl)-2-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-(4-isocyanophenyl)-2-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171586084 |
| Molecular Formula | C20H22BNO3 |
| Molecular Weight | 335.21 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 2-[4-(4-isocyanophenyl)-2-methoxyphenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(B3OC(C)(C)C(C)(C)O3)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H22BNO3/c1-19(2)20(3,4)25-21(24-19)17-12-9-15(13-18(17)23-6)14-7-10-16(22-5)11-8-14/h7-13H,1-4,6H3 |
| InChIKey | JDPVSHGNTCNDGW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 32.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.21 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|