About 4-(4-isocyanophenyl)-1,2-dimethylbenzene
4-(4-isocyanophenyl)-1,2-dimethylbenzene (PubChem CID 146830010) has the molecular formula C15H13N
and a molecular weight of 207.28 g/mol. Its IUPAC name is 4-(4-isocyanophenyl)-1,2-dimethylbenzene.
Molecular Properties
| Compound Name | 4-(4-isocyanophenyl)-1,2-dimethylbenzene |
| PubChem CID | 146830010 |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 4-(4-isocyanophenyl)-1,2-dimethylbenzene |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C15H13N/c1-11-4-5-14(10-12(11)2)13-6-8-15(16-3)9-7-13/h4-10H,1-2H3 |
| InChIKey | SDUVXKRRGRXJLN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-isocyanophenyl)-1,2-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-isocyanophenyl)-1,2-dimethylbenzene?
The IUPAC name of 4-(4-isocyanophenyl)-1,2-dimethylbenzene (CID 146830010) is 4-(4-isocyanophenyl)-1,2-dimethylbenzene.
What is the SMILES notation for 4-(4-isocyanophenyl)-1,2-dimethylbenzene?
The canonical SMILES for 4-(4-isocyanophenyl)-1,2-dimethylbenzene is [C-]#[N+]c1ccc(-c2ccc(C)c(C)c2)cc1.
What is the InChIKey of 4-(4-isocyanophenyl)-1,2-dimethylbenzene?
The InChIKey is SDUVXKRRGRXJLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N/c1-11-4-5-14(10-12(11)2)13-6-8-15(16-3)9-7-13/h4-10H,1-2H3.
What are the key properties of 4-(4-isocyanophenyl)-1,2-dimethylbenzene?
4-(4-isocyanophenyl)-1,2-dimethylbenzene has a molecular weight of 207.28 g/mol, XLogP of 4.52, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-isocyanophenyl)-1,2-dimethylbenzene is sourced from PubChem (CID 146830010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).