methyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate

C16H24O3 — CID 14401625

IUPACmethyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate
SMILESCOC(=O)CCc1cc(C(C)C)c(O)c(C(C)C)c1
InChIInChI=1S/C16H24O3/c1-10(2)13-8-12(6-7-15(17)19-5)9-14(11(3)4)16(13)18/h8-11,18H,6-7H2,1-5H3
InChIKeyQXSGOGZVOVHWEE-UHFFFAOYSA-N
MW264.36 g/mol
LogP3.74
Rot. Bonds5

About methyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate

methyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate (PubChem CID 14401625) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is methyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate.

Molecular Properties

Compound Namemethyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate
PubChem CID14401625
Molecular FormulaC16H24O3
Molecular Weight264.36 g/mol
Exact Mass264.17
IUPAC Namemethyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate
SMILESCOC(=O)CCc1cc(C(C)C)c(O)c(C(C)C)c1
InChIInChI=1S/C16H24O3/c1-10(2)13-8-12(6-7-15(17)19-5)9-14(11(3)4)16(13)18/h8-11,18H,6-7H2,1-5H3
InChIKeyQXSGOGZVOVHWEE-UHFFFAOYSA-N
XLogP3.74
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.36
LogP ≤ 53.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate?
The IUPAC name of methyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate (CID 14401625) is methyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate.
What is the SMILES notation for methyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate?
The canonical SMILES for methyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate is COC(=O)CCc1cc(C(C)C)c(O)c(C(C)C)c1.
What is the InChIKey of methyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate?
The InChIKey is QXSGOGZVOVHWEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O3/c1-10(2)13-8-12(6-7-15(17)19-5)9-14(11(3)4)16(13)18/h8-11,18H,6-7H2,1-5H3.
What are the key properties of methyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate?
methyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate has a molecular weight of 264.36 g/mol, XLogP of 3.74, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate is sourced from PubChem (CID 14401625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).