C16H24O3 — CID 14401625
methyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate (PubChem CID 14401625) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is methyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate.
| Compound Name | methyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate |
|---|---|
| PubChem CID | 14401625 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | methyl 3-[4-hydroxy-3,5-di(propan-2-yl)phenyl]propanoate |
| SMILES | COC(=O)CCc1cc(C(C)C)c(O)c(C(C)C)c1 |
| InChI | InChI=1S/C16H24O3/c1-10(2)13-8-12(6-7-15(17)19-5)9-14(11(3)4)16(13)18/h8-11,18H,6-7H2,1-5H3 |
| InChIKey | QXSGOGZVOVHWEE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |