C24H24O3S2 — CID 101010779
methyl 3-[4-hydroxy-3,5-bis[(4-methylphenyl)sulfanyl]phenyl]propanoate (PubChem CID 101010779) has the molecular formula C24H24O3S2 and a molecular weight of 424.59 g/mol. Its IUPAC name is methyl 3-[4-hydroxy-3,5-bis[(4-methylphenyl)sulfanyl]phenyl]propanoate.
| Compound Name | methyl 3-[4-hydroxy-3,5-bis[(4-methylphenyl)sulfanyl]phenyl]propanoate |
|---|---|
| PubChem CID | 101010779 |
| Molecular Formula | C24H24O3S2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | methyl 3-[4-hydroxy-3,5-bis[(4-methylphenyl)sulfanyl]phenyl]propanoate |
| SMILES | COC(=O)CCc1cc(Sc2ccc(C)cc2)c(O)c(Sc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C24H24O3S2/c1-16-4-9-19(10-5-16)28-21-14-18(8-13-23(25)27-3)15-22(24(21)26)29-20-11-6-17(2)7-12-20/h4-7,9-12,14-15,26H,8,13H2,1-3H3 |
| InChIKey | ACLAGYNEROAHKN-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |