C28H42O3 — CID 141231732
4-[2-[2-[4-hydroxy-3,5-di(propan-2-yl)phenyl]ethoxy]ethyl]-2,6-di(propan-2-yl)phenol (PubChem CID 141231732) has the molecular formula C28H42O3 and a molecular weight of 426.64 g/mol. Its IUPAC name is 4-[2-[2-[4-hydroxy-3,5-di(propan-2-yl)phenyl]ethoxy]ethyl]-2,6-di(propan-2-yl)phenol.
| Compound Name | 4-[2-[2-[4-hydroxy-3,5-di(propan-2-yl)phenyl]ethoxy]ethyl]-2,6-di(propan-2-yl)phenol |
|---|---|
| PubChem CID | 141231732 |
| Molecular Formula | C28H42O3 |
| Molecular Weight | 426.64 g/mol |
| Exact Mass | 426.31 |
| IUPAC Name | 4-[2-[2-[4-hydroxy-3,5-di(propan-2-yl)phenyl]ethoxy]ethyl]-2,6-di(propan-2-yl)phenol |
| SMILES | CC(C)c1cc(CCOCCc2cc(C(C)C)c(O)c(C(C)C)c2)cc(C(C)C)c1O |
| InChI | InChI=1S/C28H42O3/c1-17(2)23-13-21(14-24(18(3)4)27(23)29)9-11-31-12-10-22-15-25(19(5)6)28(30)26(16-22)20(7)8/h13-20,29-30H,9-12H2,1-8H3 |
| InChIKey | NAYGSPXJPYHJJK-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.64 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|