C17H29NO — CID 18958462
4-[(tert-butylamino)methyl]-2,6-di(propan-2-yl)phenol (PubChem CID 18958462) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 4-[(tert-butylamino)methyl]-2,6-di(propan-2-yl)phenol.
| Compound Name | 4-[(tert-butylamino)methyl]-2,6-di(propan-2-yl)phenol |
|---|---|
| PubChem CID | 18958462 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 4-[(tert-butylamino)methyl]-2,6-di(propan-2-yl)phenol |
| SMILES | CC(C)c1cc(CNC(C)(C)C)cc(C(C)C)c1O |
| InChI | InChI=1S/C17H29NO/c1-11(2)14-8-13(10-18-17(5,6)7)9-15(12(3)4)16(14)19/h8-9,11-12,18-19H,10H2,1-7H3 |
| InChIKey | TXPWQQIGFXWCMF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |