About CID 175952399
CID 175952399 (PubChem CID 175952399) has the molecular formula C15H26LiOSi
and a molecular weight of 257.40 g/mol.
Molecular Properties
| Compound Name | CID 175952399 |
| PubChem CID | 175952399 |
| Molecular Formula | C15H26LiOSi |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc([Si](C)(C)C)cc(C(C)C)c1O.[Li] |
| InChI | InChI=1S/C15H26OSi.Li/c1-10(2)13-8-12(17(5,6)7)9-14(11(3)4)15(13)16;/h8-11,16H,1-7H3; |
| InChIKey | SJEAAANNZPYNOY-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 175952399 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 175952399?
The IUPAC name of CID 175952399 (CID 175952399) is not available.
What is the SMILES notation for CID 175952399?
The canonical SMILES for CID 175952399 is CC(C)c1cc([Si](C)(C)C)cc(C(C)C)c1O.[Li].
What is the InChIKey of CID 175952399?
The InChIKey is SJEAAANNZPYNOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26OSi.Li/c1-10(2)13-8-12(17(5,6)7)9-14(11(3)4)15(13)16;/h8-11,16H,1-7H3;.
What are the key properties of CID 175952399?
CID 175952399 has a molecular weight of 257.40 g/mol, XLogP of 3.80, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 175952399 is sourced from PubChem (CID 175952399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).