C24H40N2O6S — CID 45074858
bis(4-amino-2,6-di(propan-2-yl)phenol);sulfuric acid (PubChem CID 45074858) has the molecular formula C24H40N2O6S and a molecular weight of 484.66 g/mol. Its IUPAC name is bis(4-amino-2,6-di(propan-2-yl)phenol);sulfuric acid.
| Compound Name | bis(4-amino-2,6-di(propan-2-yl)phenol);sulfuric acid |
|---|---|
| PubChem CID | 45074858 |
| Molecular Formula | C24H40N2O6S |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | bis(4-amino-2,6-di(propan-2-yl)phenol);sulfuric acid |
| SMILES | CC(C)c1cc(N)cc(C(C)C)c1O.CC(C)c1cc(N)cc(C(C)C)c1O.O=S(=O)(O)O |
| InChI | InChI=1S/2C12H19NO.H2O4S/c2*1-7(2)10-5-9(13)6-11(8(3)4)12(10)14;1-5(2,3)4/h2*5-8,14H,13H2,1-4H3;(H2,1,2,3,4) |
| InChIKey | GLNSZXVPFNAMIE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 167.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|