C12H20NO4P — CID 139198056
[4-amino-2,6-di(propan-2-yl)phenyl] dihydrogen phosphate (PubChem CID 139198056) has the molecular formula C12H20NO4P and a molecular weight of 273.27 g/mol. Its IUPAC name is [4-amino-2,6-di(propan-2-yl)phenyl] dihydrogen phosphate.
| Compound Name | [4-amino-2,6-di(propan-2-yl)phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 139198056 |
| Molecular Formula | C12H20NO4P |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | [4-amino-2,6-di(propan-2-yl)phenyl] dihydrogen phosphate |
| SMILES | CC(C)c1cc(N)cc(C(C)C)c1OP(=O)(O)O |
| InChI | InChI=1S/C12H20NO4P/c1-7(2)10-5-9(13)6-11(8(3)4)12(10)17-18(14,15)16/h5-8H,13H2,1-4H3,(H2,14,15,16) |
| InChIKey | TYAQVGNVAIVUEI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|