C14H23O8P — CID 122506436
(2,3,4,5-tetraethoxyphenyl) dihydrogen phosphate (PubChem CID 122506436) has the molecular formula C14H23O8P and a molecular weight of 350.30 g/mol. Its IUPAC name is (2,3,4,5-tetraethoxyphenyl) dihydrogen phosphate.
| Compound Name | (2,3,4,5-tetraethoxyphenyl) dihydrogen phosphate |
|---|---|
| PubChem CID | 122506436 |
| Molecular Formula | C14H23O8P |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | (2,3,4,5-tetraethoxyphenyl) dihydrogen phosphate |
| SMILES | CCOc1cc(OP(=O)(O)O)c(OCC)c(OCC)c1OCC |
| InChI | InChI=1S/C14H23O8P/c1-5-18-10-9-11(22-23(15,16)17)13(20-7-3)14(21-8-4)12(10)19-6-2/h9H,5-8H2,1-4H3,(H2,15,16,17) |
| InChIKey | LPBDVOVYYPVYHH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|