C28H25O5P — CID 140993891
[3-ethoxy-2-(1,2,2-triphenylethenyl)phenyl] dihydrogen phosphate (PubChem CID 140993891) has the molecular formula C28H25O5P and a molecular weight of 472.48 g/mol. Its IUPAC name is [3-ethoxy-2-(1,2,2-triphenylethenyl)phenyl] dihydrogen phosphate.
| Compound Name | [3-ethoxy-2-(1,2,2-triphenylethenyl)phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 140993891 |
| Molecular Formula | C28H25O5P |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | [3-ethoxy-2-(1,2,2-triphenylethenyl)phenyl] dihydrogen phosphate |
| SMILES | CCOc1cccc(OP(=O)(O)O)c1C(=C(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H25O5P/c1-2-32-24-19-12-20-25(33-34(29,30)31)28(24)27(23-17-10-5-11-18-23)26(21-13-6-3-7-14-21)22-15-8-4-9-16-22/h3-20H,2H2,1H3,(H2,29,30,31) |
| InChIKey | YORCYWOMCNKPTE-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|