C11H15FNO5P — CID 158731813
[2-[1-fluoro-2-oxo-2-(propylamino)ethyl]phenyl] dihydrogen phosphate (PubChem CID 158731813) has the molecular formula C11H15FNO5P and a molecular weight of 291.21 g/mol. Its IUPAC name is [2-[1-fluoro-2-oxo-2-(propylamino)ethyl]phenyl] dihydrogen phosphate.
| Compound Name | [2-[1-fluoro-2-oxo-2-(propylamino)ethyl]phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 158731813 |
| Molecular Formula | C11H15FNO5P |
| Molecular Weight | 291.21 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | [2-[1-fluoro-2-oxo-2-(propylamino)ethyl]phenyl] dihydrogen phosphate |
| SMILES | CCCNC(=O)C(F)c1ccccc1OP(=O)(O)O |
| InChI | InChI=1S/C11H15FNO5P/c1-2-7-13-11(14)10(12)8-5-3-4-6-9(8)18-19(15,16)17/h3-6,10H,2,7H2,1H3,(H,13,14)(H2,15,16,17) |
| InChIKey | NOMCHGZESLDOEK-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.21 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|