C15H22FO5P — CID 147919149
[2-(1-fluoro-6,6-dimethyl-2-oxoheptyl)phenyl] dihydrogen phosphate (PubChem CID 147919149) has the molecular formula C15H22FO5P and a molecular weight of 332.31 g/mol. Its IUPAC name is [2-(1-fluoro-6,6-dimethyl-2-oxoheptyl)phenyl] dihydrogen phosphate.
| Compound Name | [2-(1-fluoro-6,6-dimethyl-2-oxoheptyl)phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 147919149 |
| Molecular Formula | C15H22FO5P |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.12 |
| IUPAC Name | [2-(1-fluoro-6,6-dimethyl-2-oxoheptyl)phenyl] dihydrogen phosphate |
| SMILES | CC(C)(C)CCCC(=O)C(F)c1ccccc1OP(=O)(O)O |
| InChI | InChI=1S/C15H22FO5P/c1-15(2,3)10-6-8-12(17)14(16)11-7-4-5-9-13(11)21-22(18,19)20/h4-5,7,9,14H,6,8,10H2,1-3H3,(H2,18,19,20) |
| InChIKey | IHRHTUZNCJPISR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|