C17H31ClN2O — CID 139786037
4-[[2-(dimethylamino)ethylamino]methyl]-2,6-di(propan-2-yl)phenol;hydrochloride (PubChem CID 139786037) has the molecular formula C17H31ClN2O and a molecular weight of 314.90 g/mol. Its IUPAC name is 4-[[2-(dimethylamino)ethylamino]methyl]-2,6-di(propan-2-yl)phenol;hydrochloride.
| Compound Name | 4-[[2-(dimethylamino)ethylamino]methyl]-2,6-di(propan-2-yl)phenol;hydrochloride |
|---|---|
| PubChem CID | 139786037 |
| Molecular Formula | C17H31ClN2O |
| Molecular Weight | 314.90 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 4-[[2-(dimethylamino)ethylamino]methyl]-2,6-di(propan-2-yl)phenol;hydrochloride |
| SMILES | CC(C)c1cc(CNCCN(C)C)cc(C(C)C)c1O.Cl |
| InChI | InChI=1S/C17H30N2O.ClH/c1-12(2)15-9-14(11-18-7-8-19(5)6)10-16(13(3)4)17(15)20;/h9-10,12-13,18,20H,7-8,11H2,1-6H3;1H |
| InChIKey | OJXHYLHYLBQHMF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.90 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|