C11H19N3O — CID 153328752
4-amino-2-[[2-(dimethylamino)ethylamino]methyl]phenol (PubChem CID 153328752) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 4-amino-2-[[2-(dimethylamino)ethylamino]methyl]phenol.
| Compound Name | 4-amino-2-[[2-(dimethylamino)ethylamino]methyl]phenol |
|---|---|
| PubChem CID | 153328752 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 4-amino-2-[[2-(dimethylamino)ethylamino]methyl]phenol |
| SMILES | CN(C)CCNCc1cc(N)ccc1O |
| InChI | InChI=1S/C11H19N3O/c1-14(2)6-5-13-8-9-7-10(12)3-4-11(9)15/h3-4,7,13,15H,5-6,8,12H2,1-2H3 |
| InChIKey | XIRGINSBFYVCIS-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|