C12H21N3 — CID 166473574
N-[[2-(aminomethyl)phenyl]methyl]-N',N'-dimethylethane-1,2-diamine (PubChem CID 166473574) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is N-[[2-(aminomethyl)phenyl]methyl]-N',N'-dimethylethane-1,2-diamine.
| Compound Name | N-[[2-(aminomethyl)phenyl]methyl]-N',N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 166473574 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | N-[[2-(aminomethyl)phenyl]methyl]-N',N'-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCNCc1ccccc1CN |
| InChI | InChI=1S/C12H21N3/c1-15(2)8-7-14-10-12-6-4-3-5-11(12)9-13/h3-6,14H,7-10,13H2,1-2H3 |
| InChIKey | CUNJXBGBHFNPIJ-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|