C13H23N3 — CID 66385429
N-[(2-aminophenyl)methyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 66385429) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is N-[(2-aminophenyl)methyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[(2-aminophenyl)methyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 66385429 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | N-[(2-aminophenyl)methyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNCc1ccccc1N |
| InChI | InChI=1S/C13H23N3/c1-3-16(4-2)10-9-15-11-12-7-5-6-8-13(12)14/h5-8,15H,3-4,9-11,14H2,1-2H3 |
| InChIKey | KUAGJYMFRWMFRJ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|