C12H21N3 — CID 106703486
N-[(2-aminophenyl)methyl]-N'-propan-2-ylethane-1,2-diamine (PubChem CID 106703486) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is N-[(2-aminophenyl)methyl]-N'-propan-2-ylethane-1,2-diamine.
| Compound Name | N-[(2-aminophenyl)methyl]-N'-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 106703486 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | N-[(2-aminophenyl)methyl]-N'-propan-2-ylethane-1,2-diamine |
| SMILES | CC(C)NCCNCc1ccccc1N |
| InChI | InChI=1S/C12H21N3/c1-10(2)15-8-7-14-9-11-5-3-4-6-12(11)13/h3-6,10,14-15H,7-9,13H2,1-2H3 |
| InChIKey | JPSUPJOUNKOFFI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|