C13H22N2 — CID 64596728
2-[(2,3-dimethylbutylamino)methyl]aniline (PubChem CID 64596728) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-[(2,3-dimethylbutylamino)methyl]aniline.
| Compound Name | 2-[(2,3-dimethylbutylamino)methyl]aniline |
|---|---|
| PubChem CID | 64596728 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 2-[(2,3-dimethylbutylamino)methyl]aniline |
| SMILES | CC(C)C(C)CNCc1ccccc1N |
| InChI | InChI=1S/C13H22N2/c1-10(2)11(3)8-15-9-12-6-4-5-7-13(12)14/h4-7,10-11,15H,8-9,14H2,1-3H3 |
| InChIKey | DIFXARMQCFUHDO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|