About 2-[(2,3-dimethylbutylamino)methyl]pyridin-3-amine
2-[(2,3-dimethylbutylamino)methyl]pyridin-3-amine (PubChem CID 104740128) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-[(2,3-dimethylbutylamino)methyl]pyridin-3-amine.
Molecular Properties
| Compound Name | 2-[(2,3-dimethylbutylamino)methyl]pyridin-3-amine |
| PubChem CID | 104740128 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 2-[(2,3-dimethylbutylamino)methyl]pyridin-3-amine |
| SMILES | CC(C)C(C)CNCc1ncccc1N |
| InChI | InChI=1S/C12H21N3/c1-9(2)10(3)7-14-8-12-11(13)5-4-6-15-12/h4-6,9-10,14H,7-8,13H2,1-3H3 |
| InChIKey | WZLVBYFALIVFNO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2,3-dimethylbutylamino)methyl]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,3-dimethylbutylamino)methyl]pyridin-3-amine?
The IUPAC name of 2-[(2,3-dimethylbutylamino)methyl]pyridin-3-amine (CID 104740128) is 2-[(2,3-dimethylbutylamino)methyl]pyridin-3-amine.
What is the SMILES notation for 2-[(2,3-dimethylbutylamino)methyl]pyridin-3-amine?
The canonical SMILES for 2-[(2,3-dimethylbutylamino)methyl]pyridin-3-amine is CC(C)C(C)CNCc1ncccc1N.
What is the InChIKey of 2-[(2,3-dimethylbutylamino)methyl]pyridin-3-amine?
The InChIKey is WZLVBYFALIVFNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3/c1-9(2)10(3)7-14-8-12-11(13)5-4-6-15-12/h4-6,9-10,14H,7-8,13H2,1-3H3.
What are the key properties of 2-[(2,3-dimethylbutylamino)methyl]pyridin-3-amine?
2-[(2,3-dimethylbutylamino)methyl]pyridin-3-amine has a molecular weight of 207.32 g/mol, XLogP of 2.05, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3-dimethylbutylamino)methyl]pyridin-3-amine is sourced from PubChem (CID 104740128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).