C12H21N3 — CID 104740128
2-[(2,3-dimethylbutylamino)methyl]pyridin-3-amine (PubChem CID 104740128) has the molecular formula C12H21N3 and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-[(2,3-dimethylbutylamino)methyl]pyridin-3-amine.
| Compound Name | 2-[(2,3-dimethylbutylamino)methyl]pyridin-3-amine |
|---|---|
| PubChem CID | 104740128 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 2-[(2,3-dimethylbutylamino)methyl]pyridin-3-amine |
| SMILES | CC(C)C(C)CNCc1ncccc1N |
| InChI | InChI=1S/C12H21N3/c1-9(2)10(3)7-14-8-12-11(13)5-4-6-15-12/h4-6,9-10,14H,7-8,13H2,1-3H3 |
| InChIKey | WZLVBYFALIVFNO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |