C12H20N2S — CID 66418078
2-[[(2-methyl-3-methylsulfanylpropyl)amino]methyl]aniline (PubChem CID 66418078) has the molecular formula C12H20N2S and a molecular weight of 224.37 g/mol. Its IUPAC name is 2-[[(2-methyl-3-methylsulfanylpropyl)amino]methyl]aniline.
| Compound Name | 2-[[(2-methyl-3-methylsulfanylpropyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 66418078 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 2-[[(2-methyl-3-methylsulfanylpropyl)amino]methyl]aniline |
| SMILES | CSCC(C)CNCc1ccccc1N |
| InChI | InChI=1S/C12H20N2S/c1-10(9-15-2)7-14-8-11-5-3-4-6-12(11)13/h3-6,10,14H,7-9,13H2,1-2H3 |
| InChIKey | KHLNHPJYQNIZLR-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|