C10H16N2O2 — CID 66417695
2-[(2-aminophenyl)methylamino]propane-1,3-diol (PubChem CID 66417695) has the molecular formula C10H16N2O2 and a molecular weight of 196.25 g/mol. Its IUPAC name is 2-[(2-aminophenyl)methylamino]propane-1,3-diol.
| Compound Name | 2-[(2-aminophenyl)methylamino]propane-1,3-diol |
|---|---|
| PubChem CID | 66417695 |
| Molecular Formula | C10H16N2O2 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 2-[(2-aminophenyl)methylamino]propane-1,3-diol |
| SMILES | Nc1ccccc1CNC(CO)CO |
| InChI | InChI=1S/C10H16N2O2/c11-10-4-2-1-3-8(10)5-12-9(6-13)7-14/h1-4,9,12-14H,5-7,11H2 |
| InChIKey | LDSJHQDBIMUAMN-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|