C11H20ClN3O — CID 22662430
2-[(2,5-diaminophenyl)methylamino]butan-1-ol;hydrochloride (PubChem CID 22662430) has the molecular formula C11H20ClN3O and a molecular weight of 245.75 g/mol. Its IUPAC name is 2-[(2,5-diaminophenyl)methylamino]butan-1-ol;hydrochloride.
| Compound Name | 2-[(2,5-diaminophenyl)methylamino]butan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 22662430 |
| Molecular Formula | C11H20ClN3O |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | 2-[(2,5-diaminophenyl)methylamino]butan-1-ol;hydrochloride |
| SMILES | CCC(CO)NCc1cc(N)ccc1N.Cl |
| InChI | InChI=1S/C11H19N3O.ClH/c1-2-10(7-15)14-6-8-5-9(12)3-4-11(8)13;/h3-5,10,14-15H,2,6-7,12-13H2,1H3;1H |
| InChIKey | IVWRJHFWOVFIDN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|