C9H15Cl2N3O — CID 18415482
N-[(2,5-diaminophenyl)methyl]acetamide;dihydrochloride (PubChem CID 18415482) has the molecular formula C9H15Cl2N3O and a molecular weight of 252.14 g/mol. Its IUPAC name is N-[(2,5-diaminophenyl)methyl]acetamide;dihydrochloride.
| Compound Name | N-[(2,5-diaminophenyl)methyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 18415482 |
| Molecular Formula | C9H15Cl2N3O |
| Molecular Weight | 252.14 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | N-[(2,5-diaminophenyl)methyl]acetamide;dihydrochloride |
| SMILES | CC(=O)NCc1cc(N)ccc1N.Cl.Cl |
| InChI | InChI=1S/C9H13N3O.2ClH/c1-6(13)12-5-7-4-8(10)2-3-9(7)11;;/h2-4H,5,10-11H2,1H3,(H,12,13);2*1H |
| InChIKey | VGLYZRQRJDGBOC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.14 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|