C11H17N3 — CID 22662370
2-[(cyclopropylmethylamino)methyl]benzene-1,4-diamine (PubChem CID 22662370) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 2-[(cyclopropylmethylamino)methyl]benzene-1,4-diamine.
| Compound Name | 2-[(cyclopropylmethylamino)methyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 22662370 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 2-[(cyclopropylmethylamino)methyl]benzene-1,4-diamine |
| SMILES | Nc1ccc(N)c(CNCC2CC2)c1 |
| InChI | InChI=1S/C11H17N3/c12-10-3-4-11(13)9(5-10)7-14-6-8-1-2-8/h3-5,8,14H,1-2,6-7,12-13H2 |
| InChIKey | IKFLZNOGLFPGAV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|