C12H20ClN3O — CID 22328123
4-[(oxolan-2-ylmethylamino)methyl]benzene-1,3-diamine;hydrochloride (PubChem CID 22328123) has the molecular formula C12H20ClN3O and a molecular weight of 257.76 g/mol. Its IUPAC name is 4-[(oxolan-2-ylmethylamino)methyl]benzene-1,3-diamine;hydrochloride.
| Compound Name | 4-[(oxolan-2-ylmethylamino)methyl]benzene-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 22328123 |
| Molecular Formula | C12H20ClN3O |
| Molecular Weight | 257.76 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 4-[(oxolan-2-ylmethylamino)methyl]benzene-1,3-diamine;hydrochloride |
| SMILES | Cl.Nc1ccc(CNCC2CCCO2)c(N)c1 |
| InChI | InChI=1S/C12H19N3O.ClH/c13-10-4-3-9(12(14)6-10)7-15-8-11-2-1-5-16-11;/h3-4,6,11,15H,1-2,5,7-8,13-14H2;1H |
| InChIKey | VODFRLFHLCCMHN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 73.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.76 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|