C12H15Br2NO — CID 114369310
N-[(2,5-dibromophenyl)methyl]-1-(oxolan-2-yl)methanamine (PubChem CID 114369310) has the molecular formula C12H15Br2NO and a molecular weight of 349.07 g/mol. Its IUPAC name is N-[(2,5-dibromophenyl)methyl]-1-(oxolan-2-yl)methanamine.
| Compound Name | N-[(2,5-dibromophenyl)methyl]-1-(oxolan-2-yl)methanamine |
|---|---|
| PubChem CID | 114369310 |
| Molecular Formula | C12H15Br2NO |
| Molecular Weight | 349.07 g/mol |
| Exact Mass | 346.95 |
| IUPAC Name | N-[(2,5-dibromophenyl)methyl]-1-(oxolan-2-yl)methanamine |
| SMILES | Brc1ccc(Br)c(CNCC2CCCO2)c1 |
| InChI | InChI=1S/C12H15Br2NO/c13-10-3-4-12(14)9(6-10)7-15-8-11-2-1-5-16-11/h3-4,6,11,15H,1-2,5,7-8H2 |
| InChIKey | RZBUKZTWKHFBPG-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.07 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |