C14H25N3O — CID 155674929
N-[(4-amino-2-methoxyphenyl)methyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 155674929) has the molecular formula C14H25N3O and a molecular weight of 251.37 g/mol. Its IUPAC name is N-[(4-amino-2-methoxyphenyl)methyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[(4-amino-2-methoxyphenyl)methyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 155674929 |
| Molecular Formula | C14H25N3O |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | N-[(4-amino-2-methoxyphenyl)methyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNCc1ccc(N)cc1OC |
| InChI | InChI=1S/C14H25N3O/c1-4-17(5-2)9-8-16-11-12-6-7-13(15)10-14(12)18-3/h6-7,10,16H,4-5,8-9,11,15H2,1-3H3 |
| InChIKey | AFDYFNMPKQZLFG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|