C17H28N2O — CID 54849249
N',N'-diethyl-N-[[2-(2-methylprop-2-enoxy)phenyl]methyl]ethane-1,2-diamine (PubChem CID 54849249) has the molecular formula C17H28N2O and a molecular weight of 276.42 g/mol. Its IUPAC name is N',N'-diethyl-N-[[2-(2-methylprop-2-enoxy)phenyl]methyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[[2-(2-methylprop-2-enoxy)phenyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 54849249 |
| Molecular Formula | C17H28N2O |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.22 |
| IUPAC Name | N',N'-diethyl-N-[[2-(2-methylprop-2-enoxy)phenyl]methyl]ethane-1,2-diamine |
| SMILES | C=C(C)COc1ccccc1CNCCN(CC)CC |
| InChI | InChI=1S/C17H28N2O/c1-5-19(6-2)12-11-18-13-16-9-7-8-10-17(16)20-14-15(3)4/h7-10,18H,3,5-6,11-14H2,1-2,4H3 |
| InChIKey | CXXTTZGJVOPRRD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|