C20H26Cl2N2O — CID 4720063
N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-N',N'-diethylethane-1,2-diamine (PubChem CID 4720063) has the molecular formula C20H26Cl2N2O and a molecular weight of 381.35 g/mol. Its IUPAC name is N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 4720063 |
| Molecular Formula | C20H26Cl2N2O |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | N-[[2-[(2,4-dichlorophenyl)methoxy]phenyl]methyl]-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNCc1ccccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H26Cl2N2O/c1-3-24(4-2)12-11-23-14-16-7-5-6-8-20(16)25-15-17-9-10-18(21)13-19(17)22/h5-10,13,23H,3-4,11-12,14-15H2,1-2H3 |
| InChIKey | UVFXHANJMARLNQ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|