C12H22N4 — CID 86255808
N'-[[2-[(2-aminoethylamino)methyl]phenyl]methyl]ethane-1,2-diamine (PubChem CID 86255808) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is N'-[[2-[(2-aminoethylamino)methyl]phenyl]methyl]ethane-1,2-diamine.
| Compound Name | N'-[[2-[(2-aminoethylamino)methyl]phenyl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 86255808 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | N'-[[2-[(2-aminoethylamino)methyl]phenyl]methyl]ethane-1,2-diamine |
| SMILES | NCCNCc1ccccc1CNCCN |
| InChI | InChI=1S/C12H22N4/c13-5-7-15-9-11-3-1-2-4-12(11)10-16-8-6-14/h1-4,15-16H,5-10,13-14H2 |
| InChIKey | MAYMSZYIDFGXQU-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|