C9H16Cl3N3O2 — CID 175115663
N'-[(2-nitrophenyl)methyl]ethane-1,2-diamine;trihydrochloride (PubChem CID 175115663) has the molecular formula C9H16Cl3N3O2 and a molecular weight of 304.60 g/mol. Its IUPAC name is N'-[(2-nitrophenyl)methyl]ethane-1,2-diamine;trihydrochloride.
| Compound Name | N'-[(2-nitrophenyl)methyl]ethane-1,2-diamine;trihydrochloride |
|---|---|
| PubChem CID | 175115663 |
| Molecular Formula | C9H16Cl3N3O2 |
| Molecular Weight | 304.60 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | N'-[(2-nitrophenyl)methyl]ethane-1,2-diamine;trihydrochloride |
| SMILES | Cl.Cl.Cl.NCCNCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13N3O2.3ClH/c10-5-6-11-7-8-3-1-2-4-9(8)12(13)14;;;/h1-4,11H,5-7,10H2;3*1H |
| InChIKey | IVLUYZMXAIMXFS-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.60 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|