C10H15N3O2 — CID 60887414
N'-[(2-nitrophenyl)methyl]propane-1,3-diamine (PubChem CID 60887414) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is N'-[(2-nitrophenyl)methyl]propane-1,3-diamine.
| Compound Name | N'-[(2-nitrophenyl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 60887414 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | N'-[(2-nitrophenyl)methyl]propane-1,3-diamine |
| SMILES | NCCCNCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H15N3O2/c11-6-3-7-12-8-9-4-1-2-5-10(9)13(14)15/h1-2,4-5,12H,3,6-8,11H2 |
| InChIKey | UPDUIQNQURQDHA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|