C11H14N4 — CID 104614230
N'-(quinoxalin-5-ylmethyl)ethane-1,2-diamine (PubChem CID 104614230) has the molecular formula C11H14N4 and a molecular weight of 202.26 g/mol. Its IUPAC name is N'-(quinoxalin-5-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-(quinoxalin-5-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 104614230 |
| Molecular Formula | C11H14N4 |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | N'-(quinoxalin-5-ylmethyl)ethane-1,2-diamine |
| SMILES | NCCNCc1cccc2nccnc12 |
| InChI | InChI=1S/C11H14N4/c12-4-5-13-8-9-2-1-3-10-11(9)15-7-6-14-10/h1-3,6-7,13H,4-5,8,12H2 |
| InChIKey | IHDPKCQZIZIARZ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|