C9H14N2O — CID 45039184
4-amino-2-[(1,1,2,2,2-pentadeuterioethylamino)methyl]phenol (PubChem CID 45039184) has the molecular formula C9H14N2O and a molecular weight of 171.25 g/mol. Its IUPAC name is 4-amino-2-[(1,1,2,2,2-pentadeuterioethylamino)methyl]phenol.
| Compound Name | 4-amino-2-[(1,1,2,2,2-pentadeuterioethylamino)methyl]phenol |
|---|---|
| PubChem CID | 45039184 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 171.25 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 4-amino-2-[(1,1,2,2,2-pentadeuterioethylamino)methyl]phenol |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])NCc1cc(N)ccc1O |
| InChI | InChI=1S/C9H14N2O/c1-2-11-6-7-5-8(10)3-4-9(7)12/h3-5,11-12H,2,6,10H2,1H3/i1D3,2D2 |
| InChIKey | CHECSLQUJPKGOB-ZBJDZAJPSA-N |
| XLogP | 1.08 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|