C15H18N2O — CID 18533660
4-amino-2-[(3,4-dimethylanilino)methyl]phenol (PubChem CID 18533660) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 4-amino-2-[(3,4-dimethylanilino)methyl]phenol.
| Compound Name | 4-amino-2-[(3,4-dimethylanilino)methyl]phenol |
|---|---|
| PubChem CID | 18533660 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 4-amino-2-[(3,4-dimethylanilino)methyl]phenol |
| SMILES | Cc1ccc(NCc2cc(N)ccc2O)cc1C |
| InChI | InChI=1S/C15H18N2O/c1-10-3-5-14(7-11(10)2)17-9-12-8-13(16)4-6-15(12)18/h3-8,17-18H,9,16H2,1-2H3 |
| InChIKey | HXOIINCMQFHPPG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|