C15H17NOS — CID 43377168
4-amino-2-[(3,4-dimethylphenyl)sulfanylmethyl]phenol (PubChem CID 43377168) has the molecular formula C15H17NOS and a molecular weight of 259.37 g/mol. Its IUPAC name is 4-amino-2-[(3,4-dimethylphenyl)sulfanylmethyl]phenol.
| Compound Name | 4-amino-2-[(3,4-dimethylphenyl)sulfanylmethyl]phenol |
|---|---|
| PubChem CID | 43377168 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 4-amino-2-[(3,4-dimethylphenyl)sulfanylmethyl]phenol |
| SMILES | Cc1ccc(SCc2cc(N)ccc2O)cc1C |
| InChI | InChI=1S/C15H17NOS/c1-10-3-5-14(7-11(10)2)18-9-12-8-13(16)4-6-15(12)17/h3-8,17H,9,16H2,1-2H3 |
| InChIKey | SRJGHQPOZAGEOM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|