C14H16N2O2S — CID 63581352
3-[(3,4-dimethylphenyl)sulfanylmethyl]furan-2-carbohydrazide (PubChem CID 63581352) has the molecular formula C14H16N2O2S and a molecular weight of 276.36 g/mol. Its IUPAC name is 3-[(3,4-dimethylphenyl)sulfanylmethyl]furan-2-carbohydrazide.
| Compound Name | 3-[(3,4-dimethylphenyl)sulfanylmethyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 63581352 |
| Molecular Formula | C14H16N2O2S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 3-[(3,4-dimethylphenyl)sulfanylmethyl]furan-2-carbohydrazide |
| SMILES | Cc1ccc(SCc2ccoc2C(=O)NN)cc1C |
| InChI | InChI=1S/C14H16N2O2S/c1-9-3-4-12(7-10(9)2)19-8-11-5-6-18-13(11)14(17)16-15/h3-7H,8,15H2,1-2H3,(H,16,17) |
| InChIKey | BCHUJWFVAQDMKO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 68.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|