About 4-amino-2-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenol
4-amino-2-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenol (PubChem CID 102924761) has the molecular formula C14H16N2OS
and a molecular weight of 260.36 g/mol. Its IUPAC name is 4-amino-2-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenol.
Molecular Properties
| Compound Name | 4-amino-2-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenol |
| PubChem CID | 102924761 |
| Molecular Formula | C14H16N2OS |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | 4-amino-2-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenol |
| SMILES | Cc1cc(C)nc(SCc2cc(N)ccc2O)c1 |
| InChI | InChI=1S/C14H16N2OS/c1-9-5-10(2)16-14(6-9)18-8-11-7-12(15)3-4-13(11)17/h3-7,17H,8,15H2,1-2H3 |
| InChIKey | HOZLFIXQZFUEHD-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-2-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenol?
The IUPAC name of 4-amino-2-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenol (CID 102924761) is 4-amino-2-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenol.
What is the SMILES notation for 4-amino-2-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenol?
The canonical SMILES for 4-amino-2-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenol is Cc1cc(C)nc(SCc2cc(N)ccc2O)c1.
What is the InChIKey of 4-amino-2-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenol?
The InChIKey is HOZLFIXQZFUEHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2OS/c1-9-5-10(2)16-14(6-9)18-8-11-7-12(15)3-4-13(11)17/h3-7,17H,8,15H2,1-2H3.
What are the key properties of 4-amino-2-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenol?
4-amino-2-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenol has a molecular weight of 260.36 g/mol, XLogP of 3.28, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]phenol is sourced from PubChem (CID 102924761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).