C13H12Cl2N2S — CID 106994859
2,6-dichloro-3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]pyridine (PubChem CID 106994859) has the molecular formula C13H12Cl2N2S and a molecular weight of 299.23 g/mol. Its IUPAC name is 2,6-dichloro-3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]pyridine.
| Compound Name | 2,6-dichloro-3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]pyridine |
|---|---|
| PubChem CID | 106994859 |
| Molecular Formula | C13H12Cl2N2S |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 2,6-dichloro-3-[(4,6-dimethyl-2-pyridinyl)sulfanylmethyl]pyridine |
| SMILES | Cc1cc(C)nc(SCc2ccc(Cl)nc2Cl)c1 |
| InChI | InChI=1S/C13H12Cl2N2S/c1-8-5-9(2)16-12(6-8)18-7-10-3-4-11(14)17-13(10)15/h3-6H,7H2,1-2H3 |
| InChIKey | MQFSEWJFJSLZMR-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|