C14H14BrNS — CID 102925539
2-[(3-bromophenyl)methylsulfanyl]-4,6-dimethylpyridine (PubChem CID 102925539) has the molecular formula C14H14BrNS and a molecular weight of 308.24 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methylsulfanyl]-4,6-dimethylpyridine.
| Compound Name | 2-[(3-bromophenyl)methylsulfanyl]-4,6-dimethylpyridine |
|---|---|
| PubChem CID | 102925539 |
| Molecular Formula | C14H14BrNS |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | 2-[(3-bromophenyl)methylsulfanyl]-4,6-dimethylpyridine |
| SMILES | Cc1cc(C)nc(SCc2cccc(Br)c2)c1 |
| InChI | InChI=1S/C14H14BrNS/c1-10-6-11(2)16-14(7-10)17-9-12-4-3-5-13(15)8-12/h3-8H,9H2,1-2H3 |
| InChIKey | LXYXVWKUYGERBB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |