C12H23N5 — CID 90053317
1-N-[2-[2-(dimethylamino)ethylamino]ethyl]benzene-1,2,4-triamine (PubChem CID 90053317) has the molecular formula C12H23N5 and a molecular weight of 237.35 g/mol. Its IUPAC name is 1-N-[2-[2-(dimethylamino)ethylamino]ethyl]benzene-1,2,4-triamine.
| Compound Name | 1-N-[2-[2-(dimethylamino)ethylamino]ethyl]benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 90053317 |
| Molecular Formula | C12H23N5 |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.20 |
| IUPAC Name | 1-N-[2-[2-(dimethylamino)ethylamino]ethyl]benzene-1,2,4-triamine |
| SMILES | CN(C)CCNCCNc1ccc(N)cc1N |
| InChI | InChI=1S/C12H23N5/c1-17(2)8-7-15-5-6-16-12-4-3-10(13)9-11(12)14/h3-4,9,15-16H,5-8,13-14H2,1-2H3 |
| InChIKey | IZWHTFYRMKUHRV-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 79.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|