C10H17N3O — CID 118147492
4-amino-3-[2-(dimethylamino)ethylamino]phenol (PubChem CID 118147492) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 4-amino-3-[2-(dimethylamino)ethylamino]phenol.
| Compound Name | 4-amino-3-[2-(dimethylamino)ethylamino]phenol |
|---|---|
| PubChem CID | 118147492 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 4-amino-3-[2-(dimethylamino)ethylamino]phenol |
| SMILES | CN(C)CCNc1cc(O)ccc1N |
| InChI | InChI=1S/C10H17N3O/c1-13(2)6-5-12-10-7-8(14)3-4-9(10)11/h3-4,7,12,14H,5-6,11H2,1-2H3 |
| InChIKey | COXJIWQTXBCZAZ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|